C13H20O — CID 23592581
(3,5-dipropylphenyl)methanol (PubChem CID 23592581) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (3,5-dipropylphenyl)methanol.
| Compound Name | (3,5-dipropylphenyl)methanol |
|---|---|
| PubChem CID | 23592581 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (3,5-dipropylphenyl)methanol |
| SMILES | CCCc1cc(CO)cc(CCC)c1 |
| InChI | InChI=1S/C13H20O/c1-3-5-11-7-12(6-4-2)9-13(8-11)10-14/h7-9,14H,3-6,10H2,1-2H3 |
| InChIKey | FWZOTCPQXJWOIS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |