C9H11BF2O3 — CID 141479444
(2,3-difluoro-6-hydroxy-4-propylphenyl)boronic acid (PubChem CID 141479444) has the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. Its IUPAC name is (2,3-difluoro-6-hydroxy-4-propylphenyl)boronic acid.
| Compound Name | (2,3-difluoro-6-hydroxy-4-propylphenyl)boronic acid |
|---|---|
| PubChem CID | 141479444 |
| Molecular Formula | C9H11BF2O3 |
| Molecular Weight | 215.99 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (2,3-difluoro-6-hydroxy-4-propylphenyl)boronic acid |
| SMILES | CCCc1cc(O)c(B(O)O)c(F)c1F |
| InChI | InChI=1S/C9H11BF2O3/c1-2-3-5-4-6(13)7(10(14)15)9(12)8(5)11/h4,13-15H,2-3H2,1H3 |
| InChIKey | XSMGOGWYTODIBS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.99 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|