C24H28ClFO2 — CID 89046701
2-[2-chloro-3-fluoro-4-[4-[4-(3-methoxypropyl)cyclohexyl]phenyl]phenyl]oxirane (PubChem CID 89046701) has the molecular formula C24H28ClFO2 and a molecular weight of 402.94 g/mol. Its IUPAC name is 2-[2-chloro-3-fluoro-4-[4-[4-(3-methoxypropyl)cyclohexyl]phenyl]phenyl]oxirane.
| Compound Name | 2-[2-chloro-3-fluoro-4-[4-[4-(3-methoxypropyl)cyclohexyl]phenyl]phenyl]oxirane |
|---|---|
| PubChem CID | 89046701 |
| Molecular Formula | C24H28ClFO2 |
| Molecular Weight | 402.94 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-[2-chloro-3-fluoro-4-[4-[4-(3-methoxypropyl)cyclohexyl]phenyl]phenyl]oxirane |
| SMILES | COCCCC1CCC(c2ccc(-c3ccc(C4CO4)c(Cl)c3F)cc2)CC1 |
| InChI | InChI=1S/C24H28ClFO2/c1-27-14-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-13-21(22-15-28-22)23(25)24(20)26/h8-13,16-17,22H,2-7,14-15H2,1H3 |
| InChIKey | KTRZDWNLENEWKJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.94 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|