C18H24O — CID 139985225
1-ethynyl-4-[4-(3-methoxypropyl)cyclohexyl]benzene (PubChem CID 139985225) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-ethynyl-4-[4-(3-methoxypropyl)cyclohexyl]benzene.
| Compound Name | 1-ethynyl-4-[4-(3-methoxypropyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 139985225 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-ethynyl-4-[4-(3-methoxypropyl)cyclohexyl]benzene |
| SMILES | C#Cc1ccc(C2CCC(CCCOC)CC2)cc1 |
| InChI | InChI=1S/C18H24O/c1-3-15-6-10-17(11-7-15)18-12-8-16(9-13-18)5-4-14-19-2/h1,6-7,10-11,16,18H,4-5,8-9,12-14H2,2H3 |
| InChIKey | YDWNNZGVXZHCNJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|