C23H37ClOSi — CID 54541634
4-[2-[4-(4-chlorophenyl)cyclohexyl]ethyl]-1-(3-methoxypropyl)silinane (PubChem CID 54541634) has the molecular formula C23H37ClOSi and a molecular weight of 393.09 g/mol. Its IUPAC name is 4-[2-[4-(4-chlorophenyl)cyclohexyl]ethyl]-1-(3-methoxypropyl)silinane.
| Compound Name | 4-[2-[4-(4-chlorophenyl)cyclohexyl]ethyl]-1-(3-methoxypropyl)silinane |
|---|---|
| PubChem CID | 54541634 |
| Molecular Formula | C23H37ClOSi |
| Molecular Weight | 393.09 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 4-[2-[4-(4-chlorophenyl)cyclohexyl]ethyl]-1-(3-methoxypropyl)silinane |
| SMILES | COCCC[SiH]1CCC(CCC2CCC(c3ccc(Cl)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H37ClOSi/c1-25-15-2-16-26-17-13-20(14-18-26)4-3-19-5-7-21(8-6-19)22-9-11-23(24)12-10-22/h9-12,19-21,26H,2-8,13-18H2,1H3 |
| InChIKey | ZDPOMVFMHVKGKW-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.09 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|