C23H36F2OSi — CID 67579549
4-[2-[4-(3,4-difluorophenyl)cyclohexyl]ethyl]-1-(3-methoxypropyl)silinane (PubChem CID 67579549) has the molecular formula C23H36F2OSi and a molecular weight of 394.62 g/mol. Its IUPAC name is 4-[2-[4-(3,4-difluorophenyl)cyclohexyl]ethyl]-1-(3-methoxypropyl)silinane.
| Compound Name | 4-[2-[4-(3,4-difluorophenyl)cyclohexyl]ethyl]-1-(3-methoxypropyl)silinane |
|---|---|
| PubChem CID | 67579549 |
| Molecular Formula | C23H36F2OSi |
| Molecular Weight | 394.62 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 4-[2-[4-(3,4-difluorophenyl)cyclohexyl]ethyl]-1-(3-methoxypropyl)silinane |
| SMILES | COCCC[SiH]1CCC(CCC2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H36F2OSi/c1-26-13-2-14-27-15-11-19(12-16-27)4-3-18-5-7-20(8-6-18)21-9-10-22(24)23(25)17-21/h9-10,17-20,27H,2-8,11-16H2,1H3 |
| InChIKey | KQLQTVQAEHNCFI-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|