C20H27F2Re- — CID 163819599
4-[4-(2-cyclohexylethyl)cyclohexyl]-1,2-difluorobenzene;rhenium (PubChem CID 163819599) has the molecular formula C20H27F2Re- and a molecular weight of 491.64 g/mol. Its IUPAC name is 4-[4-(2-cyclohexylethyl)cyclohexyl]-1,2-difluorobenzene;rhenium.
| Compound Name | 4-[4-(2-cyclohexylethyl)cyclohexyl]-1,2-difluorobenzene;rhenium |
|---|---|
| PubChem CID | 163819599 |
| Molecular Formula | C20H27F2Re- |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 4-[4-(2-cyclohexylethyl)cyclohexyl]-1,2-difluorobenzene;rhenium |
| SMILES | Fc1ccc(C2CCC(CCC3CC[CH-]CC3)CC2)cc1F.[Re] |
| InChI | InChI=1S/C20H27F2.Re/c21-19-13-12-18(14-20(19)22)17-10-8-16(9-11-17)7-6-15-4-2-1-3-5-15;/h1,12-17H,2-11H2;/q-1; |
| InChIKey | VFSPRXVEEMZYTH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|