C23H36F2Si — CID 20683498
2-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]ethyl-trimethylsilane (PubChem CID 20683498) has the molecular formula C23H36F2Si and a molecular weight of 378.62 g/mol. Its IUPAC name is 2-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]ethyl-trimethylsilane.
| Compound Name | 2-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 20683498 |
| Molecular Formula | C23H36F2Si |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 2-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H36F2Si/c1-26(2,3)15-14-17-4-6-18(7-5-17)19-8-10-20(11-9-19)21-12-13-22(24)23(25)16-21/h12-13,16-20H,4-11,14-15H2,1-3H3 |
| InChIKey | RXEDHJWWSFAENW-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|