C19H29F3O2Si — CID 54736791
4-[4-(2,2-difluoroethoxy)-3-fluorophenyl]-1-(5-methoxypentyl)silinane (PubChem CID 54736791) has the molecular formula C19H29F3O2Si and a molecular weight of 374.52 g/mol. Its IUPAC name is 4-[4-(2,2-difluoroethoxy)-3-fluorophenyl]-1-(5-methoxypentyl)silinane.
| Compound Name | 4-[4-(2,2-difluoroethoxy)-3-fluorophenyl]-1-(5-methoxypentyl)silinane |
|---|---|
| PubChem CID | 54736791 |
| Molecular Formula | C19H29F3O2Si |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-[4-(2,2-difluoroethoxy)-3-fluorophenyl]-1-(5-methoxypentyl)silinane |
| SMILES | COCCCCC[SiH]1CCC(c2ccc(OCC(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H29F3O2Si/c1-23-9-3-2-4-10-25-11-7-15(8-12-25)16-5-6-18(17(20)13-16)24-14-19(21)22/h5-6,13,15,19,25H,2-4,7-12,14H2,1H3 |
| InChIKey | VVNFQVZOLVXGOK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|