C25H29F5OSi — CID 54730456
4-[4-[4-(1,2-difluoroethenyl)-3-fluorophenyl]-3,5-difluorophenyl]-1-(5-methoxypentyl)silinane (PubChem CID 54730456) has the molecular formula C25H29F5OSi and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-[4-[4-(1,2-difluoroethenyl)-3-fluorophenyl]-3,5-difluorophenyl]-1-(5-methoxypentyl)silinane.
| Compound Name | 4-[4-[4-(1,2-difluoroethenyl)-3-fluorophenyl]-3,5-difluorophenyl]-1-(5-methoxypentyl)silinane |
|---|---|
| PubChem CID | 54730456 |
| Molecular Formula | C25H29F5OSi |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 4-[4-[4-(1,2-difluoroethenyl)-3-fluorophenyl]-3,5-difluorophenyl]-1-(5-methoxypentyl)silinane |
| SMILES | COCCCCC[SiH]1CCC(c2cc(F)c(-c3ccc(C(F)=CF)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H29F5OSi/c1-31-9-3-2-4-10-32-11-7-17(8-12-32)19-14-22(28)25(23(29)15-19)18-5-6-20(21(27)13-18)24(30)16-26/h5-6,13-17,32H,2-4,7-12H2,1H3 |
| InChIKey | OFUVXKMVOMCSRY-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|