C21H22ClF — CID 19095005
2-chloro-1-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]benzene (PubChem CID 19095005) has the molecular formula C21H22ClF and a molecular weight of 328.86 g/mol. Its IUPAC name is 2-chloro-1-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]benzene.
| Compound Name | 2-chloro-1-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 19095005 |
| Molecular Formula | C21H22ClF |
| Molecular Weight | 328.86 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-chloro-1-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]benzene |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(F)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C21H22ClF/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)19-12-13-21(23)20(22)14-19/h2-3,8-16H,4-7H2,1H3/b3-2+ |
| InChIKey | VYAXGNVVMXDUPB-NSCUHMNNSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.86 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|