C39H47F3 — CID 67738080
1-[(Z)-but-2-enyl]-2,3-difluoro-4-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]benzene (PubChem CID 67738080) has the molecular formula C39H47F3 and a molecular weight of 572.80 g/mol. Its IUPAC name is 1-[(Z)-but-2-enyl]-2,3-difluoro-4-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]benzene.
| Compound Name | 1-[(Z)-but-2-enyl]-2,3-difluoro-4-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 67738080 |
| Molecular Formula | C39H47F3 |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 572.36 |
| IUPAC Name | 1-[(Z)-but-2-enyl]-2,3-difluoro-4-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]benzene |
| SMILES | C/C=C\Cc1ccc(-c2ccc(-c3ccc(C4CCC(C5CCC(CCCCC)CC5)CC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C39H47F3/c1-3-5-7-8-27-10-12-28(13-11-27)29-14-18-31(19-15-29)35-24-23-34(26-37(35)40)30-16-20-32(21-17-30)36-25-22-33(9-6-4-2)38(41)39(36)42/h4,6,16-17,20-29,31H,3,5,7-15,18-19H2,1-2H3/b6-4- |
| InChIKey | SPKUOQLRKPKZII-XQRVVYSFSA-N |
| XLogP | 12.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|