C41H51F3 — CID 67738094
2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-[(Z)-hex-2-enyl]benzene (PubChem CID 67738094) has the molecular formula C41H51F3 and a molecular weight of 600.85 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-[(Z)-hex-2-enyl]benzene.
| Compound Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-[(Z)-hex-2-enyl]benzene |
|---|---|
| PubChem CID | 67738094 |
| Molecular Formula | C41H51F3 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.39 |
| IUPAC Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-4-[(Z)-hex-2-enyl]benzene |
| SMILES | CCC/C=C\Cc1ccc(-c2ccc(-c3ccc(C4CCC(C5CCC(CCCCC)CC5)CC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C41H51F3/c1-3-5-7-9-11-35-24-27-38(41(44)40(35)43)34-22-18-32(19-23-34)36-25-26-37(39(42)28-36)33-20-16-31(17-21-33)30-14-12-29(13-15-30)10-8-6-4-2/h7,9,18-19,22-31,33H,3-6,8,10-17,20-21H2,1-2H3/b9-7- |
| InChIKey | XZIKPSCQOCKTTO-CLFYSBASSA-N |
| XLogP | 13.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|