C27H32F4 — CID 22123891
1-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluoro-4-[(E)-non-1-enyl]benzene (PubChem CID 22123891) has the molecular formula C27H32F4 and a molecular weight of 432.55 g/mol. Its IUPAC name is 1-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluoro-4-[(E)-non-1-enyl]benzene.
| Compound Name | 1-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluoro-4-[(E)-non-1-enyl]benzene |
|---|---|
| PubChem CID | 22123891 |
| Molecular Formula | C27H32F4 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 1-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluoro-4-[(E)-non-1-enyl]benzene |
| SMILES | CCCCCCC/C=C/c1ccc(-c2ccc(C3CCC(F)(F)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C27H32F4/c1-2-3-4-5-6-7-8-9-23-14-15-24(26(29)25(23)28)22-12-10-20(11-13-22)21-16-18-27(30,31)19-17-21/h8-15,21H,2-7,16-19H2,1H3/b9-8+ |
| InChIKey | ZEVCDWHBDGIICQ-CMDGGOBGSA-N |
| XLogP | 9.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|