C7H4Br2F2 — CID 118824651
1,3-dibromo-2-fluoro-4-(fluoromethyl)benzene (PubChem CID 118824651) has the molecular formula C7H4Br2F2 and a molecular weight of 285.91 g/mol. Its IUPAC name is 1,3-dibromo-2-fluoro-4-(fluoromethyl)benzene.
| Compound Name | 1,3-dibromo-2-fluoro-4-(fluoromethyl)benzene |
|---|---|
| PubChem CID | 118824651 |
| Molecular Formula | C7H4Br2F2 |
| Molecular Weight | 285.91 g/mol |
| Exact Mass | 283.86 |
| IUPAC Name | 1,3-dibromo-2-fluoro-4-(fluoromethyl)benzene |
| SMILES | FCc1ccc(Br)c(F)c1Br |
| InChI | InChI=1S/C7H4Br2F2/c8-5-2-1-4(3-10)6(9)7(5)11/h1-2H,3H2 |
| InChIKey | NYTRPKPCEWGJAF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.91 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|