C14H10Br4F2 — CID 91474323
2,3-dibromo-1-fluoro-4-methylbenzene;2,4-dibromo-1-(fluoromethyl)benzene (PubChem CID 91474323) has the molecular formula C14H10Br4F2 and a molecular weight of 535.85 g/mol. Its IUPAC name is 2,3-dibromo-1-fluoro-4-methylbenzene;2,4-dibromo-1-(fluoromethyl)benzene.
| Compound Name | 2,3-dibromo-1-fluoro-4-methylbenzene;2,4-dibromo-1-(fluoromethyl)benzene |
|---|---|
| PubChem CID | 91474323 |
| Molecular Formula | C14H10Br4F2 |
| Molecular Weight | 535.85 g/mol |
| Exact Mass | 531.75 |
| IUPAC Name | 2,3-dibromo-1-fluoro-4-methylbenzene;2,4-dibromo-1-(fluoromethyl)benzene |
| SMILES | Cc1ccc(F)c(Br)c1Br.FCc1ccc(Br)cc1Br |
| InChI | InChI=1S/2C7H5Br2F/c1-4-2-3-5(10)7(9)6(4)8;8-6-2-1-5(4-10)7(9)3-6/h2-3H,1H3;1-3H,4H2 |
| InChIKey | DOLKGYVSBDJRML-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.85 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|