C14H9Br5F2 — CID 91311747
2,4-dibromo-1-(fluoromethyl)benzene;1,3,4-tribromo-2-fluoro-5-methylbenzene (PubChem CID 91311747) has the molecular formula C14H9Br5F2 and a molecular weight of 614.74 g/mol. Its IUPAC name is 2,4-dibromo-1-(fluoromethyl)benzene;1,3,4-tribromo-2-fluoro-5-methylbenzene.
| Compound Name | 2,4-dibromo-1-(fluoromethyl)benzene;1,3,4-tribromo-2-fluoro-5-methylbenzene |
|---|---|
| PubChem CID | 91311747 |
| Molecular Formula | C14H9Br5F2 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 609.66 |
| IUPAC Name | 2,4-dibromo-1-(fluoromethyl)benzene;1,3,4-tribromo-2-fluoro-5-methylbenzene |
| SMILES | Cc1cc(Br)c(F)c(Br)c1Br.FCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C7H4Br3F.C7H5Br2F/c1-3-2-4(8)7(11)6(10)5(3)9;8-6-2-1-5(4-10)7(9)3-6/h2H,1H3;1-3H,4H2 |
| InChIKey | CPBVQIXKRRISFI-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|