C14H11Br5 — CID 158762510
1,4-dibromo-2-(bromomethyl)benzene;1,4-dibromo-2-methylbenzene (PubChem CID 158762510) has the molecular formula C14H11Br5 and a molecular weight of 578.76 g/mol. Its IUPAC name is 1,4-dibromo-2-(bromomethyl)benzene;1,4-dibromo-2-methylbenzene.
| Compound Name | 1,4-dibromo-2-(bromomethyl)benzene;1,4-dibromo-2-methylbenzene |
|---|---|
| PubChem CID | 158762510 |
| Molecular Formula | C14H11Br5 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 573.68 |
| IUPAC Name | 1,4-dibromo-2-(bromomethyl)benzene;1,4-dibromo-2-methylbenzene |
| SMILES | BrCc1cc(Br)ccc1Br.Cc1cc(Br)ccc1Br |
| InChI | InChI=1S/C7H5Br3.C7H6Br2/c8-4-5-3-6(9)1-2-7(5)10;1-5-4-6(8)2-3-7(5)9/h1-3H,4H2;2-4H,1H3 |
| InChIKey | IOVSTAYROYTRKL-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|