C12H14Br2 — CID 83925856
1,4-dibromo-2-[(Z)-2-methylpent-3-enyl]benzene (PubChem CID 83925856) has the molecular formula C12H14Br2 and a molecular weight of 318.05 g/mol. Its IUPAC name is 1,4-dibromo-2-[(Z)-2-methylpent-3-enyl]benzene.
| Compound Name | 1,4-dibromo-2-[(Z)-2-methylpent-3-enyl]benzene |
|---|---|
| PubChem CID | 83925856 |
| Molecular Formula | C12H14Br2 |
| Molecular Weight | 318.05 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 1,4-dibromo-2-[(Z)-2-methylpent-3-enyl]benzene |
| SMILES | C/C=C\C(C)Cc1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H14Br2/c1-3-4-9(2)7-10-8-11(13)5-6-12(10)14/h3-6,8-9H,7H2,1-2H3/b4-3- |
| InChIKey | SAYFLLZWQLQVGP-ARJAWSKDSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.05 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|