C9H11Br2N — CID 84739331
1-(2,5-dibromophenyl)propan-2-amine (PubChem CID 84739331) has the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)propan-2-amine.
| Compound Name | 1-(2,5-dibromophenyl)propan-2-amine |
|---|---|
| PubChem CID | 84739331 |
| Molecular Formula | C9H11Br2N |
| Molecular Weight | 293.00 g/mol |
| Exact Mass | 290.93 |
| IUPAC Name | 1-(2,5-dibromophenyl)propan-2-amine |
| SMILES | CC(N)Cc1cc(Br)ccc1Br |
| InChI | InChI=1S/C9H11Br2N/c1-6(12)4-7-5-8(10)2-3-9(7)11/h2-3,5-6H,4,12H2,1H3 |
| InChIKey | VUONVZBZJUAMBR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.00 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |