C8H6Br4 — CID 640222
1,4-dibromo-2,5-bis(bromomethyl)benzene (PubChem CID 640222) has the molecular formula C8H6Br4 and a molecular weight of 421.75 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis(bromomethyl)benzene.
| Compound Name | 1,4-dibromo-2,5-bis(bromomethyl)benzene |
|---|---|
| PubChem CID | 640222 |
| Molecular Formula | C8H6Br4 |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 417.72 |
| IUPAC Name | 1,4-dibromo-2,5-bis(bromomethyl)benzene |
| SMILES | BrCc1cc(Br)c(CBr)cc1Br |
| InChI | InChI=1S/C8H6Br4/c9-3-5-1-7(11)6(4-10)2-8(5)12/h1-2H,3-4H2 |
| InChIKey | UOCMTKLYRROETA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|