C7H5Br4N — CID 175165901
2,3,4-tribromo-6-(bromomethyl)aniline (PubChem CID 175165901) has the molecular formula C7H5Br4N and a molecular weight of 422.74 g/mol. Its IUPAC name is 2,3,4-tribromo-6-(bromomethyl)aniline.
| Compound Name | 2,3,4-tribromo-6-(bromomethyl)aniline |
|---|---|
| PubChem CID | 175165901 |
| Molecular Formula | C7H5Br4N |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 418.72 |
| IUPAC Name | 2,3,4-tribromo-6-(bromomethyl)aniline |
| SMILES | Nc1c(CBr)cc(Br)c(Br)c1Br |
| InChI | InChI=1S/C7H5Br4N/c8-2-3-1-4(9)5(10)6(11)7(3)12/h1H,2,12H2 |
| InChIKey | WYSSYZJOYLMKHT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|