C7H8Br2N2 — CID 163970562
3-bromo-6-(bromomethyl)benzene-1,2-diamine (PubChem CID 163970562) has the molecular formula C7H8Br2N2 and a molecular weight of 279.96 g/mol. Its IUPAC name is 3-bromo-6-(bromomethyl)benzene-1,2-diamine.
| Compound Name | 3-bromo-6-(bromomethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 163970562 |
| Molecular Formula | C7H8Br2N2 |
| Molecular Weight | 279.96 g/mol |
| Exact Mass | 277.91 |
| IUPAC Name | 3-bromo-6-(bromomethyl)benzene-1,2-diamine |
| SMILES | Nc1c(Br)ccc(CBr)c1N |
| InChI | InChI=1S/C7H8Br2N2/c8-3-4-1-2-5(9)7(11)6(4)10/h1-2H,3,10-11H2 |
| InChIKey | SPQAYEIQGJPUAL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.96 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|