C7H6Br3N — CID 164893724
3,4,6-tribromo-2-methylaniline (PubChem CID 164893724) has the molecular formula C7H6Br3N and a molecular weight of 343.84 g/mol. Its IUPAC name is 3,4,6-tribromo-2-methylaniline.
| Compound Name | 3,4,6-tribromo-2-methylaniline |
|---|---|
| PubChem CID | 164893724 |
| Molecular Formula | C7H6Br3N |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 340.81 |
| IUPAC Name | 3,4,6-tribromo-2-methylaniline |
| SMILES | Cc1c(N)c(Br)cc(Br)c1Br |
| InChI | InChI=1S/C7H6Br3N/c1-3-6(10)4(8)2-5(9)7(3)11/h2H,11H2,1H3 |
| InChIKey | GEYHZUNOVOGZEH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|