C7H7Br3N2 — CID 157076540
2,4,6-tribromo-5-methylbenzene-1,3-diamine (PubChem CID 157076540) has the molecular formula C7H7Br3N2 and a molecular weight of 358.86 g/mol. Its IUPAC name is 2,4,6-tribromo-5-methylbenzene-1,3-diamine.
| Compound Name | 2,4,6-tribromo-5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 157076540 |
| Molecular Formula | C7H7Br3N2 |
| Molecular Weight | 358.86 g/mol |
| Exact Mass | 355.82 |
| IUPAC Name | 2,4,6-tribromo-5-methylbenzene-1,3-diamine |
| SMILES | Cc1c(Br)c(N)c(Br)c(N)c1Br |
| InChI | InChI=1S/C7H7Br3N2/c1-2-3(8)6(11)5(10)7(12)4(2)9/h11-12H2,1H3 |
| InChIKey | DRNHIOATSWIJIE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.86 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|