C8H8Br2FNO — CID 134599260
2,6-dibromo-4-fluoro-3-methoxy-5-methylaniline (PubChem CID 134599260) has the molecular formula C8H8Br2FNO and a molecular weight of 312.96 g/mol. Its IUPAC name is 2,6-dibromo-4-fluoro-3-methoxy-5-methylaniline.
| Compound Name | 2,6-dibromo-4-fluoro-3-methoxy-5-methylaniline |
|---|---|
| PubChem CID | 134599260 |
| Molecular Formula | C8H8Br2FNO |
| Molecular Weight | 312.96 g/mol |
| Exact Mass | 310.90 |
| IUPAC Name | 2,6-dibromo-4-fluoro-3-methoxy-5-methylaniline |
| SMILES | COc1c(F)c(C)c(Br)c(N)c1Br |
| InChI | InChI=1S/C8H8Br2FNO/c1-3-4(9)7(12)5(10)8(13-2)6(3)11/h12H2,1-2H3 |
| InChIKey | NDIVSORSVUFILX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.96 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|