C6H3Br3FNO — CID 10666436
2,4,6-tribromo-3-fluoro-5-methoxypyridine (PubChem CID 10666436) has the molecular formula C6H3Br3FNO and a molecular weight of 363.81 g/mol. Its IUPAC name is 2,4,6-tribromo-3-fluoro-5-methoxypyridine.
| Compound Name | 2,4,6-tribromo-3-fluoro-5-methoxypyridine |
|---|---|
| PubChem CID | 10666436 |
| Molecular Formula | C6H3Br3FNO |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 360.77 |
| IUPAC Name | 2,4,6-tribromo-3-fluoro-5-methoxypyridine |
| SMILES | COc1c(Br)nc(Br)c(F)c1Br |
| InChI | InChI=1S/C6H3Br3FNO/c1-12-4-2(7)3(10)5(8)11-6(4)9/h1H3 |
| InChIKey | XXAPGTYXMXWDGI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|