C7H6BrF2NO — CID 141136680
2-bromo-3,5-difluoro-4-methoxyaniline (PubChem CID 141136680) has the molecular formula C7H6BrF2NO and a molecular weight of 238.03 g/mol. Its IUPAC name is 2-bromo-3,5-difluoro-4-methoxyaniline.
| Compound Name | 2-bromo-3,5-difluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 141136680 |
| Molecular Formula | C7H6BrF2NO |
| Molecular Weight | 238.03 g/mol |
| Exact Mass | 236.96 |
| IUPAC Name | 2-bromo-3,5-difluoro-4-methoxyaniline |
| SMILES | COc1c(F)cc(N)c(Br)c1F |
| InChI | InChI=1S/C7H6BrF2NO/c1-12-7-3(9)2-4(11)5(8)6(7)10/h2H,11H2,1H3 |
| InChIKey | OGOCMIJVFVKSHN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.03 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|