C9H11BrF2O — CID 144516394
5-bromo-1,3-difluoro-2-methoxybenzene;ethane (PubChem CID 144516394) has the molecular formula C9H11BrF2O and a molecular weight of 253.09 g/mol. Its IUPAC name is 5-bromo-1,3-difluoro-2-methoxybenzene;ethane.
| Compound Name | 5-bromo-1,3-difluoro-2-methoxybenzene;ethane |
|---|---|
| PubChem CID | 144516394 |
| Molecular Formula | C9H11BrF2O |
| Molecular Weight | 253.09 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 5-bromo-1,3-difluoro-2-methoxybenzene;ethane |
| SMILES | CC.COc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C7H5BrF2O.C2H6/c1-11-7-5(9)2-4(8)3-6(7)10;1-2/h2-3H,1H3;1-2H3 |
| InChIKey | MCDDCEXFGAEXOE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.09 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |