C16H16Br4 — CID 159795233
1,2,4,5-tetrabromo-3,6-dimethylbenzene;1,4-xylene (PubChem CID 159795233) has the molecular formula C16H16Br4 and a molecular weight of 527.92 g/mol. Its IUPAC name is 1,2,4,5-tetrabromo-3,6-dimethylbenzene;1,4-xylene.
| Compound Name | 1,2,4,5-tetrabromo-3,6-dimethylbenzene;1,4-xylene |
|---|---|
| PubChem CID | 159795233 |
| Molecular Formula | C16H16Br4 |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 523.80 |
| IUPAC Name | 1,2,4,5-tetrabromo-3,6-dimethylbenzene;1,4-xylene |
| SMILES | Cc1c(Br)c(Br)c(C)c(Br)c1Br.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H6Br4.C8H10/c1-3-5(9)7(11)4(2)8(12)6(3)10;1-7-3-5-8(2)6-4-7/h1-2H3;3-6H,1-2H3 |
| InChIKey | NJBSZHHLFCONKA-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|