C6H2Br3I2N — CID 4172413
2,4,6-tribromo-3,5-diiodoaniline (PubChem CID 4172413) has the molecular formula C6H2Br3I2N and a molecular weight of 581.61 g/mol. Its IUPAC name is 2,4,6-tribromo-3,5-diiodoaniline.
| Compound Name | 2,4,6-tribromo-3,5-diiodoaniline |
|---|---|
| PubChem CID | 4172413 |
| Molecular Formula | C6H2Br3I2N |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 578.58 |
| IUPAC Name | 2,4,6-tribromo-3,5-diiodoaniline |
| SMILES | Nc1c(Br)c(I)c(Br)c(I)c1Br |
| InChI | InChI=1S/C6H2Br3I2N/c7-1-4(10)2(8)6(12)3(9)5(1)11/h12H2 |
| InChIKey | DBIRYRIKJHAUQX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|