About 2,4,6-tribromo-3,5-diiodoaniline
2,4,6-tribromo-3,5-diiodoaniline (PubChem CID 4172413) has the molecular formula C6H2Br3I2N
and a molecular weight of 581.61 g/mol. Its IUPAC name is 2,4,6-tribromo-3,5-diiodoaniline.
Molecular Properties
| Compound Name | 2,4,6-tribromo-3,5-diiodoaniline |
| PubChem CID | 4172413 |
| Molecular Formula | C6H2Br3I2N |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 578.58 |
| IUPAC Name | 2,4,6-tribromo-3,5-diiodoaniline |
| SMILES | Nc1c(Br)c(I)c(Br)c(I)c1Br |
| InChI | InChI=1S/C6H2Br3I2N/c7-1-4(10)2(8)6(12)3(9)5(1)11/h12H2 |
| InChIKey | DBIRYRIKJHAUQX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-tribromo-3,5-diiodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-tribromo-3,5-diiodoaniline?
The IUPAC name of 2,4,6-tribromo-3,5-diiodoaniline (CID 4172413) is 2,4,6-tribromo-3,5-diiodoaniline.
What is the SMILES notation for 2,4,6-tribromo-3,5-diiodoaniline?
The canonical SMILES for 2,4,6-tribromo-3,5-diiodoaniline is Nc1c(Br)c(I)c(Br)c(I)c1Br.
What is the InChIKey of 2,4,6-tribromo-3,5-diiodoaniline?
The InChIKey is DBIRYRIKJHAUQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Br3I2N/c7-1-4(10)2(8)6(12)3(9)5(1)11/h12H2.
What are the key properties of 2,4,6-tribromo-3,5-diiodoaniline?
2,4,6-tribromo-3,5-diiodoaniline has a molecular weight of 581.61 g/mol, XLogP of 4.77, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-tribromo-3,5-diiodoaniline is sourced from PubChem (CID 4172413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).