C8H6Br2I2 — CID 643341
1,2-dibromo-3,6-diiodo-4,5-dimethylbenzene (PubChem CID 643341) has the molecular formula C8H6Br2I2 and a molecular weight of 515.75 g/mol. Its IUPAC name is 1,2-dibromo-3,6-diiodo-4,5-dimethylbenzene.
| Compound Name | 1,2-dibromo-3,6-diiodo-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 643341 |
| Molecular Formula | C8H6Br2I2 |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 513.69 |
| IUPAC Name | 1,2-dibromo-3,6-diiodo-4,5-dimethylbenzene |
| SMILES | Cc1c(C)c(I)c(Br)c(Br)c1I |
| InChI | InChI=1S/C8H6Br2I2/c1-3-4(2)8(12)6(10)5(9)7(3)11/h1-2H3 |
| InChIKey | OWNRRMKZYFVZCC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|