C8H10BrIN2 — CID 155980084
3-bromo-5-iodo-N,N,4-trimethylpyridin-2-amine (PubChem CID 155980084) has the molecular formula C8H10BrIN2 and a molecular weight of 340.99 g/mol. Its IUPAC name is 3-bromo-5-iodo-N,N,4-trimethylpyridin-2-amine.
| Compound Name | 3-bromo-5-iodo-N,N,4-trimethylpyridin-2-amine |
|---|---|
| PubChem CID | 155980084 |
| Molecular Formula | C8H10BrIN2 |
| Molecular Weight | 340.99 g/mol |
| Exact Mass | 339.91 |
| IUPAC Name | 3-bromo-5-iodo-N,N,4-trimethylpyridin-2-amine |
| SMILES | Cc1c(I)cnc(N(C)C)c1Br |
| InChI | InChI=1S/C8H10BrIN2/c1-5-6(10)4-11-8(7(5)9)12(2)3/h4H,1-3H3 |
| InChIKey | BYKDDUGTJZBRQR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.99 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|