C11H18N2 — CID 130320637
N,N,3-trimethyl-5-propan-2-ylpyridin-2-amine (PubChem CID 130320637) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N,N,3-trimethyl-5-propan-2-ylpyridin-2-amine.
| Compound Name | N,N,3-trimethyl-5-propan-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 130320637 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N,N,3-trimethyl-5-propan-2-ylpyridin-2-amine |
| SMILES | Cc1cc(C(C)C)cnc1N(C)C |
| InChI | InChI=1S/C11H18N2/c1-8(2)10-6-9(3)11(12-7-10)13(4)5/h6-8H,1-5H3 |
| InChIKey | MLZOFIMANVNOEK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |