About Tripelennamine Hydrochloride
Tripelennamine Hydrochloride (PubChem CID 9066) has the molecular formula C16H22ClN3
and a molecular weight of 291.82 g/mol. Its IUPAC name is N'-benzyl-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | Tripelennamine Hydrochloride |
| PubChem CID | 9066 |
| Molecular Formula | C16H22ClN3 |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N'-benzyl-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine;hydrochloride |
| SMILES | CN(C)CCN(CC1=CC=CC=C1)C2=CC=CC=N2.Cl |
| InChI | InChI=1S/C16H21N3.ClH/c1-18(2)12-13-19(16-10-6-7-11-17-16)14-15-8-4-3-5-9-15;/h3-11H,12-14H2,1-2H3;1H |
| InChIKey | FSSICIQKZGUEAE-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 19.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 236 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Tripelennamine Hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tripelennamine Hydrochloride?
The IUPAC name of Tripelennamine Hydrochloride (CID 9066) is N'-benzyl-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine;hydrochloride.
What is the SMILES notation for Tripelennamine Hydrochloride?
The canonical SMILES for Tripelennamine Hydrochloride is CN(C)CCN(CC1=CC=CC=C1)C2=CC=CC=N2.Cl.
What is the InChIKey of Tripelennamine Hydrochloride?
The InChIKey is FSSICIQKZGUEAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3.ClH/c1-18(2)12-13-19(16-10-6-7-11-17-16)14-15-8-4-3-5-9-15;/h3-11H,12-14H2,1-2H3;1H.
What are the key properties of Tripelennamine Hydrochloride?
Tripelennamine Hydrochloride has a molecular weight of 291.82 g/mol, XLogP of not available, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Tripelennamine Hydrochloride is sourced from PubChem (CID 9066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).