C11H14IU- — CID 59967837
1-iodo-2-methanidyl-3,4,5,6-tetramethylbenzene;uranium (PubChem CID 59967837) has the molecular formula C11H14IU- and a molecular weight of 511.17 g/mol. Its IUPAC name is 1-iodo-2-methanidyl-3,4,5,6-tetramethylbenzene;uranium.
| Compound Name | 1-iodo-2-methanidyl-3,4,5,6-tetramethylbenzene;uranium |
|---|---|
| PubChem CID | 59967837 |
| Molecular Formula | C11H14IU- |
| Molecular Weight | 511.17 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 1-iodo-2-methanidyl-3,4,5,6-tetramethylbenzene;uranium |
| SMILES | [CH2-]c1c(C)c(C)c(C)c(C)c1I.[U] |
| InChI | InChI=1S/C11H14I.U/c1-6-7(2)9(4)11(12)10(5)8(6)3;/h4H2,1-3,5H3;/q-1; |
| InChIKey | CQJDOOGMLHHWLO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|