C8H9ClIN — CID 131701568
2-chloro-3-iodo-4,5,6-trimethylpyridine (PubChem CID 131701568) has the molecular formula C8H9ClIN and a molecular weight of 281.52 g/mol. Its IUPAC name is 2-chloro-3-iodo-4,5,6-trimethylpyridine.
| Compound Name | 2-chloro-3-iodo-4,5,6-trimethylpyridine |
|---|---|
| PubChem CID | 131701568 |
| Molecular Formula | C8H9ClIN |
| Molecular Weight | 281.52 g/mol |
| Exact Mass | 280.95 |
| IUPAC Name | 2-chloro-3-iodo-4,5,6-trimethylpyridine |
| SMILES | Cc1nc(Cl)c(I)c(C)c1C |
| InChI | InChI=1S/C8H9ClIN/c1-4-5(2)7(10)8(9)11-6(4)3/h1-3H3 |
| InChIKey | AYOMQKJCTYKNPJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|