About 2,4-dichloro-5,6-dimethylpyrimidine
2,4-dichloro-5,6-dimethylpyrimidine (PubChem CID 156777151) has the molecular formula C12H12Cl4N4
and a molecular weight of 354.07 g/mol. Its IUPAC name is 2,4-dichloro-5,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-5,6-dimethylpyrimidine |
| PubChem CID | 156777151 |
| Molecular Formula | C12H12Cl4N4 |
| Molecular Weight | 354.07 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 2,4-dichloro-5,6-dimethylpyrimidine |
| SMILES | Cc1nc(Cl)nc(Cl)c1C.Cc1nc(Cl)nc(Cl)c1C |
| InChI | InChI=1S/2C6H6Cl2N2/c2*1-3-4(2)9-6(8)10-5(3)7/h2*1-2H3 |
| InChIKey | PNFXSMAMJWVEOM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.07 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dichloro-5,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-5,6-dimethylpyrimidine?
The IUPAC name of 2,4-dichloro-5,6-dimethylpyrimidine (CID 156777151) is 2,4-dichloro-5,6-dimethylpyrimidine.
What is the SMILES notation for 2,4-dichloro-5,6-dimethylpyrimidine?
The canonical SMILES for 2,4-dichloro-5,6-dimethylpyrimidine is Cc1nc(Cl)nc(Cl)c1C.Cc1nc(Cl)nc(Cl)c1C.
What is the InChIKey of 2,4-dichloro-5,6-dimethylpyrimidine?
The InChIKey is PNFXSMAMJWVEOM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6Cl2N2/c2*1-3-4(2)9-6(8)10-5(3)7/h2*1-2H3.
What are the key properties of 2,4-dichloro-5,6-dimethylpyrimidine?
2,4-dichloro-5,6-dimethylpyrimidine has a molecular weight of 354.07 g/mol, XLogP of 4.80, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5,6-dimethylpyrimidine is sourced from PubChem (CID 156777151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).