C5H3Cl2IN2O2S — CID 133080967
4,6-dichloro-5-iodo-2-methylsulfonylpyrimidine (PubChem CID 133080967) has the molecular formula C5H3Cl2IN2O2S and a molecular weight of 352.97 g/mol. Its IUPAC name is 4,6-dichloro-5-iodo-2-methylsulfonylpyrimidine.
| Compound Name | 4,6-dichloro-5-iodo-2-methylsulfonylpyrimidine |
|---|---|
| PubChem CID | 133080967 |
| Molecular Formula | C5H3Cl2IN2O2S |
| Molecular Weight | 352.97 g/mol |
| Exact Mass | 351.83 |
| IUPAC Name | 4,6-dichloro-5-iodo-2-methylsulfonylpyrimidine |
| SMILES | CS(=O)(=O)c1nc(Cl)c(I)c(Cl)n1 |
| InChI | InChI=1S/C5H3Cl2IN2O2S/c1-13(11,12)5-9-3(6)2(8)4(7)10-5/h1H3 |
| InChIKey | FHNJKEXKESRKPQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.97 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|