C14H15Cl2N3O2S — CID 87636483
6-chloro-5-(2-chlorophenyl)-2-methylsulfonyl-N-propan-2-ylpyrimidin-4-amine (PubChem CID 87636483) has the molecular formula C14H15Cl2N3O2S and a molecular weight of 360.27 g/mol. Its IUPAC name is 6-chloro-5-(2-chlorophenyl)-2-methylsulfonyl-N-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-(2-chlorophenyl)-2-methylsulfonyl-N-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 87636483 |
| Molecular Formula | C14H15Cl2N3O2S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 6-chloro-5-(2-chlorophenyl)-2-methylsulfonyl-N-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)Nc1nc(S(C)(=O)=O)nc(Cl)c1-c1ccccc1Cl |
| InChI | InChI=1S/C14H15Cl2N3O2S/c1-8(2)17-13-11(9-6-4-5-7-10(9)15)12(16)18-14(19-13)22(3,20)21/h4-8H,1-3H3,(H,17,18,19) |
| InChIKey | QKSBMCWUAPGXDF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |