C18H13Cl2N3O3S — CID 155664577
4-(2-chloroanilino)-6-(2-chlorophenyl)-2-methylsulfonylpyrimidine-5-carbaldehyde (PubChem CID 155664577) has the molecular formula C18H13Cl2N3O3S and a molecular weight of 422.29 g/mol. Its IUPAC name is 4-(2-chloroanilino)-6-(2-chlorophenyl)-2-methylsulfonylpyrimidine-5-carbaldehyde.
| Compound Name | 4-(2-chloroanilino)-6-(2-chlorophenyl)-2-methylsulfonylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 155664577 |
| Molecular Formula | C18H13Cl2N3O3S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 4-(2-chloroanilino)-6-(2-chlorophenyl)-2-methylsulfonylpyrimidine-5-carbaldehyde |
| SMILES | CS(=O)(=O)c1nc(Nc2ccccc2Cl)c(C=O)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C18H13Cl2N3O3S/c1-27(25,26)18-22-16(11-6-2-3-7-13(11)19)12(10-24)17(23-18)21-15-9-5-4-8-14(15)20/h2-10H,1H3,(H,21,22,23) |
| InChIKey | ALYXETCCFLYQAK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|