C21H17Cl2N3O2S — CID 66893539
methyl 3-[4-(2-chloroanilino)-6-(2-chlorophenyl)-2-methylsulfanylpyrimidin-5-yl]prop-2-enoate (PubChem CID 66893539) has the molecular formula C21H17Cl2N3O2S and a molecular weight of 446.36 g/mol. Its IUPAC name is methyl 3-[4-(2-chloroanilino)-6-(2-chlorophenyl)-2-methylsulfanylpyrimidin-5-yl]prop-2-enoate.
| Compound Name | methyl 3-[4-(2-chloroanilino)-6-(2-chlorophenyl)-2-methylsulfanylpyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 66893539 |
| Molecular Formula | C21H17Cl2N3O2S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | methyl 3-[4-(2-chloroanilino)-6-(2-chlorophenyl)-2-methylsulfanylpyrimidin-5-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1c(Nc2ccccc2Cl)nc(SC)nc1-c1ccccc1Cl |
| InChI | InChI=1S/C21H17Cl2N3O2S/c1-28-18(27)12-11-14-19(13-7-3-4-8-15(13)22)25-21(29-2)26-20(14)24-17-10-6-5-9-16(17)23/h3-12H,1-2H3,(H,24,25,26) |
| InChIKey | XMQAASYEHSICOM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|