C18H14ClN3O2S — CID 59639611
4-(2-chloroanilino)-2-methylsulfanyl-6-phenoxypyrimidine-5-carbaldehyde (PubChem CID 59639611) has the molecular formula C18H14ClN3O2S and a molecular weight of 371.85 g/mol. Its IUPAC name is 4-(2-chloroanilino)-2-methylsulfanyl-6-phenoxypyrimidine-5-carbaldehyde.
| Compound Name | 4-(2-chloroanilino)-2-methylsulfanyl-6-phenoxypyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 59639611 |
| Molecular Formula | C18H14ClN3O2S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 4-(2-chloroanilino)-2-methylsulfanyl-6-phenoxypyrimidine-5-carbaldehyde |
| SMILES | CSc1nc(Nc2ccccc2Cl)c(C=O)c(Oc2ccccc2)n1 |
| InChI | InChI=1S/C18H14ClN3O2S/c1-25-18-21-16(20-15-10-6-5-9-14(15)19)13(11-23)17(22-18)24-12-7-3-2-4-8-12/h2-11H,1H3,(H,20,21,22) |
| InChIKey | DHEVFRZGQQHKLH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|