C16H16ClN3O2S — CID 89026717
4-[benzyl(3-oxopropyl)amino]-6-chloro-2-methylsulfanylpyrimidine-5-carbaldehyde (PubChem CID 89026717) has the molecular formula C16H16ClN3O2S and a molecular weight of 349.84 g/mol. Its IUPAC name is 4-[benzyl(3-oxopropyl)amino]-6-chloro-2-methylsulfanylpyrimidine-5-carbaldehyde.
| Compound Name | 4-[benzyl(3-oxopropyl)amino]-6-chloro-2-methylsulfanylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 89026717 |
| Molecular Formula | C16H16ClN3O2S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-[benzyl(3-oxopropyl)amino]-6-chloro-2-methylsulfanylpyrimidine-5-carbaldehyde |
| SMILES | CSc1nc(Cl)c(C=O)c(N(CCC=O)Cc2ccccc2)n1 |
| InChI | InChI=1S/C16H16ClN3O2S/c1-23-16-18-14(17)13(11-22)15(19-16)20(8-5-9-21)10-12-6-3-2-4-7-12/h2-4,6-7,9,11H,5,8,10H2,1H3 |
| InChIKey | FUWJANYZXQLHTD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|