C13H11ClFN3O — CID 80732979
4-chloro-6-(3-fluoro-2-methylanilino)-2-methylpyrimidine-5-carbaldehyde (PubChem CID 80732979) has the molecular formula C13H11ClFN3O and a molecular weight of 279.70 g/mol. Its IUPAC name is 4-chloro-6-(3-fluoro-2-methylanilino)-2-methylpyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-6-(3-fluoro-2-methylanilino)-2-methylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 80732979 |
| Molecular Formula | C13H11ClFN3O |
| Molecular Weight | 279.70 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 4-chloro-6-(3-fluoro-2-methylanilino)-2-methylpyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(Cl)c(C=O)c(Nc2cccc(F)c2C)n1 |
| InChI | InChI=1S/C13H11ClFN3O/c1-7-10(15)4-3-5-11(7)18-13-9(6-19)12(14)16-8(2)17-13/h3-6H,1-2H3,(H,16,17,18) |
| InChIKey | BPGUCEOQQNFBBI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|