C13H11BrClN3O2 — CID 80732122
4-(5-bromo-2-methoxyanilino)-6-chloro-2-methylpyrimidine-5-carbaldehyde (PubChem CID 80732122) has the molecular formula C13H11BrClN3O2 and a molecular weight of 356.61 g/mol. Its IUPAC name is 4-(5-bromo-2-methoxyanilino)-6-chloro-2-methylpyrimidine-5-carbaldehyde.
| Compound Name | 4-(5-bromo-2-methoxyanilino)-6-chloro-2-methylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 80732122 |
| Molecular Formula | C13H11BrClN3O2 |
| Molecular Weight | 356.61 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 4-(5-bromo-2-methoxyanilino)-6-chloro-2-methylpyrimidine-5-carbaldehyde |
| SMILES | COc1ccc(Br)cc1Nc1nc(C)nc(Cl)c1C=O |
| InChI | InChI=1S/C13H11BrClN3O2/c1-7-16-12(15)9(6-19)13(17-7)18-10-5-8(14)3-4-11(10)20-2/h3-6H,1-2H3,(H,16,17,18) |
| InChIKey | NHHKOWVRQWXLEA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|