C12H11BrCl2N4O — CID 102761817
N-(5-bromo-2-methoxyphenyl)-3,5-dichloro-6-hydrazinylpyridin-2-amine (PubChem CID 102761817) has the molecular formula C12H11BrCl2N4O and a molecular weight of 378.06 g/mol. Its IUPAC name is N-(5-bromo-2-methoxyphenyl)-3,5-dichloro-6-hydrazinylpyridin-2-amine.
| Compound Name | N-(5-bromo-2-methoxyphenyl)-3,5-dichloro-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 102761817 |
| Molecular Formula | C12H11BrCl2N4O |
| Molecular Weight | 378.06 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | N-(5-bromo-2-methoxyphenyl)-3,5-dichloro-6-hydrazinylpyridin-2-amine |
| SMILES | COc1ccc(Br)cc1Nc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H11BrCl2N4O/c1-20-10-3-2-6(13)4-9(10)17-11-7(14)5-8(15)12(18-11)19-16/h2-5H,16H2,1H3,(H2,17,18,19) |
| InChIKey | AGJQMLNJQNNDIX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.06 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|