C17H18ClN3O3S — CID 67549951
methyl 3-[4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidin-5-yl]prop-2-enoate (PubChem CID 67549951) has the molecular formula C17H18ClN3O3S and a molecular weight of 379.87 g/mol. Its IUPAC name is methyl 3-[4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidin-5-yl]prop-2-enoate.
| Compound Name | methyl 3-[4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67549951 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | methyl 3-[4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidin-5-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cnc(SC)nc1NCc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O3S/c1-23-14-6-4-11(8-13(14)18)9-19-16-12(5-7-15(22)24-2)10-20-17(21-16)25-3/h4-8,10H,9H2,1-3H3,(H,19,20,21) |
| InChIKey | TZOUTXOUXGWETN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|