C18H13BrCl2N2O3 — CID 18518416
6-bromo-2-chloro-4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-3-carboxylic acid (PubChem CID 18518416) has the molecular formula C18H13BrCl2N2O3 and a molecular weight of 456.12 g/mol. Its IUPAC name is 6-bromo-2-chloro-4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-3-carboxylic acid.
| Compound Name | 6-bromo-2-chloro-4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 18518416 |
| Molecular Formula | C18H13BrCl2N2O3 |
| Molecular Weight | 456.12 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | 6-bromo-2-chloro-4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-3-carboxylic acid |
| SMILES | COc1ccc(CNc2c(C(=O)O)c(Cl)nc3ccc(Br)cc23)cc1Cl |
| InChI | InChI=1S/C18H13BrCl2N2O3/c1-26-14-5-2-9(6-12(14)20)8-22-16-11-7-10(19)3-4-13(11)23-17(21)15(16)18(24)25/h2-7H,8H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | OGSJGUFHLARFBD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.12 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|