C19H17ClN2O2 — CID 123765275
4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylquinoline-3-carbaldehyde (PubChem CID 123765275) has the molecular formula C19H17ClN2O2 and a molecular weight of 340.81 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylquinoline-3-carbaldehyde.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 123765275 |
| Molecular Formula | C19H17ClN2O2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylquinoline-3-carbaldehyde |
| SMILES | COc1ccc(CNc2c(C=O)c(C)nc3ccccc23)cc1Cl |
| InChI | InChI=1S/C19H17ClN2O2/c1-12-15(11-23)19(14-5-3-4-6-17(14)22-12)21-10-13-7-8-18(24-2)16(20)9-13/h3-9,11H,10H2,1-2H3,(H,21,22) |
| InChIKey | PZULNWWTNFTRJQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|